C15H8FLiN2O3 — CID 139035725
lithium 5-fluoro-4-oxo-3-phenylquinazoline-2-carboxylate (PubChem CID 139035725) has the molecular formula C15H8FLiN2O3 and a molecular weight of 290.18 g/mol. Its IUPAC name is lithium 5-fluoro-4-oxo-3-phenylquinazoline-2-carboxylate.
| Compound Name | lithium 5-fluoro-4-oxo-3-phenylquinazoline-2-carboxylate |
|---|---|
| PubChem CID | 139035725 |
| Molecular Formula | C15H8FLiN2O3 |
| Molecular Weight | 290.18 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | lithium 5-fluoro-4-oxo-3-phenylquinazoline-2-carboxylate |
| SMILES | O=C([O-])c1nc2cccc(F)c2c(=O)n1-c1ccccc1.[Li+] |
| InChI | InChI=1S/C15H9FN2O3.Li/c16-10-7-4-8-11-12(10)14(19)18(13(17-11)15(20)21)9-5-2-1-3-6-9;/h1-8H,(H,20,21);/q;+1/p-1 |
| InChIKey | FXSUXHZAPHLLOE-UHFFFAOYSA-M |
| XLogP | -2.11 |
| TPSA | 75.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.18 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |