C19H17F2NO4 — CID 137465751
bis(3-fluorophenyl) piperidine-1,3-dicarboxylate (PubChem CID 137465751) has the molecular formula C19H17F2NO4 and a molecular weight of 361.34 g/mol. Its IUPAC name is bis(3-fluorophenyl) piperidine-1,3-dicarboxylate.
| Compound Name | bis(3-fluorophenyl) piperidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 137465751 |
| Molecular Formula | C19H17F2NO4 |
| Molecular Weight | 361.34 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | bis(3-fluorophenyl) piperidine-1,3-dicarboxylate |
| SMILES | O=C(Oc1cccc(F)c1)C1CCCN(C(=O)Oc2cccc(F)c2)C1 |
| InChI | InChI=1S/C19H17F2NO4/c20-14-5-1-7-16(10-14)25-18(23)13-4-3-9-22(12-13)19(24)26-17-8-2-6-15(21)11-17/h1-2,5-8,10-11,13H,3-4,9,12H2 |
| InChIKey | UHMQPLKCBNPRQV-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.34 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|