C19H24ClN3OS — CID 137467426
S-[4-[3-[(5-chloro-2-methoxyanilino)methyl]-2,2-dimethylcyclopropyl]anilino]thiohydroxylamine (PubChem CID 137467426) has the molecular formula C19H24ClN3OS and a molecular weight of 377.94 g/mol. Its IUPAC name is S-[4-[3-[(5-chloro-2-methoxyanilino)methyl]-2,2-dimethylcyclopropyl]anilino]thiohydroxylamine.
| Compound Name | S-[4-[3-[(5-chloro-2-methoxyanilino)methyl]-2,2-dimethylcyclopropyl]anilino]thiohydroxylamine |
|---|---|
| PubChem CID | 137467426 |
| Molecular Formula | C19H24ClN3OS |
| Molecular Weight | 377.94 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | S-[4-[3-[(5-chloro-2-methoxyanilino)methyl]-2,2-dimethylcyclopropyl]anilino]thiohydroxylamine |
| SMILES | COc1ccc(Cl)cc1NCC1C(c2ccc(NSN)cc2)C1(C)C |
| InChI | InChI=1S/C19H24ClN3OS/c1-19(2)15(11-22-16-10-13(20)6-9-17(16)24-3)18(19)12-4-7-14(8-5-12)23-25-21/h4-10,15,18,22-23H,11,21H2,1-3H3 |
| InChIKey | LKEMVPTUUCGQJH-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.94 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|