C19H23ClN2O4S — CID 160919527
4-[(1S,3S)-3-[(5-chloro-2-methoxyanilino)methyl]-2,2-dimethylcyclopropyl]-N-hydroxybenzenesulfonamide (PubChem CID 160919527) has the molecular formula C19H23ClN2O4S and a molecular weight of 410.92 g/mol. Its IUPAC name is 4-[(1S,3S)-3-[(5-chloro-2-methoxyanilino)methyl]-2,2-dimethylcyclopropyl]-N-hydroxybenzenesulfonamide.
| Compound Name | 4-[(1S,3S)-3-[(5-chloro-2-methoxyanilino)methyl]-2,2-dimethylcyclopropyl]-N-hydroxybenzenesulfonamide |
|---|---|
| PubChem CID | 160919527 |
| Molecular Formula | C19H23ClN2O4S |
| Molecular Weight | 410.92 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | 4-[(1S,3S)-3-[(5-chloro-2-methoxyanilino)methyl]-2,2-dimethylcyclopropyl]-N-hydroxybenzenesulfonamide |
| SMILES | COc1ccc(Cl)cc1NC[C@H]1[C@H](c2ccc(S(=O)(=O)NO)cc2)C1(C)C |
| InChI | InChI=1S/C19H23ClN2O4S/c1-19(2)15(11-21-16-10-13(20)6-9-17(16)26-3)18(19)12-4-7-14(8-5-12)27(24,25)22-23/h4-10,15,18,21-23H,11H2,1-3H3/t15-,18-/m0/s1 |
| InChIKey | SRVPIZHBQNKZSO-YJBOKZPZSA-N |
| XLogP | 3.87 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.92 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|