C22H29FN2O3S — CID 163963741
4-[(1R,3R)-3-[(2-butoxy-5-fluoroanilino)methyl]-2,2-dimethylcyclopropyl]benzenesulfonamide (PubChem CID 163963741) has the molecular formula C22H29FN2O3S and a molecular weight of 420.55 g/mol. Its IUPAC name is 4-[(1R,3R)-3-[(2-butoxy-5-fluoroanilino)methyl]-2,2-dimethylcyclopropyl]benzenesulfonamide.
| Compound Name | 4-[(1R,3R)-3-[(2-butoxy-5-fluoroanilino)methyl]-2,2-dimethylcyclopropyl]benzenesulfonamide |
|---|---|
| PubChem CID | 163963741 |
| Molecular Formula | C22H29FN2O3S |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 4-[(1R,3R)-3-[(2-butoxy-5-fluoroanilino)methyl]-2,2-dimethylcyclopropyl]benzenesulfonamide |
| SMILES | CCCCOc1ccc(F)cc1NC[C@@H]1[C@@H](c2ccc(S(N)(=O)=O)cc2)C1(C)C |
| InChI | InChI=1S/C22H29FN2O3S/c1-4-5-12-28-20-11-8-16(23)13-19(20)25-14-18-21(22(18,2)3)15-6-9-17(10-7-15)29(24,26)27/h6-11,13,18,21,25H,4-5,12,14H2,1-3H3,(H2,24,26,27)/t18-,21-/m1/s1 |
| InChIKey | SJUMUWOKNVCMDI-WIYYLYMNSA-N |
| XLogP | 4.50 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|