C15H22ClN3OS — CID 155259923
S-[2-[(5-chloro-2-methoxyanilino)methyl]-6-azaspiro[2.5]octan-6-yl]thiohydroxylamine (PubChem CID 155259923) has the molecular formula C15H22ClN3OS and a molecular weight of 327.88 g/mol. Its IUPAC name is S-[2-[(5-chloro-2-methoxyanilino)methyl]-6-azaspiro[2.5]octan-6-yl]thiohydroxylamine.
| Compound Name | S-[2-[(5-chloro-2-methoxyanilino)methyl]-6-azaspiro[2.5]octan-6-yl]thiohydroxylamine |
|---|---|
| PubChem CID | 155259923 |
| Molecular Formula | C15H22ClN3OS |
| Molecular Weight | 327.88 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | S-[2-[(5-chloro-2-methoxyanilino)methyl]-6-azaspiro[2.5]octan-6-yl]thiohydroxylamine |
| SMILES | COc1ccc(Cl)cc1NCC1CC12CCN(SN)CC2 |
| InChI | InChI=1S/C15H22ClN3OS/c1-20-14-3-2-12(16)8-13(14)18-10-11-9-15(11)4-6-19(21-17)7-5-15/h2-3,8,11,18H,4-7,9-10,17H2,1H3 |
| InChIKey | HIUTVUFRRUOVKB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.88 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|