C18H27NO — CID 137469836
1-[(6S)-6-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-3,6-dihydro-2H-pyridin-1-yl]-2,2-dimethylbutan-1-one (PubChem CID 137469836) has the molecular formula C18H27NO and a molecular weight of 273.42 g/mol. Its IUPAC name is 1-[(6S)-6-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-3,6-dihydro-2H-pyridin-1-yl]-2,2-dimethylbutan-1-one.
| Compound Name | 1-[(6S)-6-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-3,6-dihydro-2H-pyridin-1-yl]-2,2-dimethylbutan-1-one |
|---|---|
| PubChem CID | 137469836 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | 1-[(6S)-6-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-3,6-dihydro-2H-pyridin-1-yl]-2,2-dimethylbutan-1-one |
| SMILES | C=C(/C=C\C=C/C)[C@@H]1C=CCCN1C(=O)C(C)(C)CC |
| InChI | InChI=1S/C18H27NO/c1-6-8-9-12-15(3)16-13-10-11-14-19(16)17(20)18(4,5)7-2/h6,8-10,12-13,16H,3,7,11,14H2,1-2,4-5H3/b8-6-,12-9-/t16-/m0/s1 |
| InChIKey | YJZJYCFYXMNZPC-ZSCLOILISA-N |
| XLogP | 4.27 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|