C22H31O3P — CID 137470268
2-[benzyl(ethoxy)phosphoryl]oxy-1-butan-2-yl-3-propylbenzene (PubChem CID 137470268) has the molecular formula C22H31O3P and a molecular weight of 374.46 g/mol. Its IUPAC name is 2-[benzyl(ethoxy)phosphoryl]oxy-1-butan-2-yl-3-propylbenzene.
| Compound Name | 2-[benzyl(ethoxy)phosphoryl]oxy-1-butan-2-yl-3-propylbenzene |
|---|---|
| PubChem CID | 137470268 |
| Molecular Formula | C22H31O3P |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 2-[benzyl(ethoxy)phosphoryl]oxy-1-butan-2-yl-3-propylbenzene |
| SMILES | CCCc1cccc(C(C)CC)c1OP(=O)(Cc1ccccc1)OCC |
| InChI | InChI=1S/C22H31O3P/c1-5-12-20-15-11-16-21(18(4)6-2)22(20)25-26(23,24-7-3)17-19-13-9-8-10-14-19/h8-11,13-16,18H,5-7,12,17H2,1-4H3 |
| InChIKey | WAGPONDQBLMRII-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|