C28H42NO5P — CID 163214461
(2S)-2-[[[2,6-di(propan-2-yl)phenoxy]-ethoxyphosphoryl]-pentan-3-ylamino]-3-phenylpropanoic acid (PubChem CID 163214461) has the molecular formula C28H42NO5P and a molecular weight of 503.62 g/mol. Its IUPAC name is (2S)-2-[[[2,6-di(propan-2-yl)phenoxy]-ethoxyphosphoryl]-pentan-3-ylamino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[[2,6-di(propan-2-yl)phenoxy]-ethoxyphosphoryl]-pentan-3-ylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 163214461 |
| Molecular Formula | C28H42NO5P |
| Molecular Weight | 503.62 g/mol |
| Exact Mass | 503.28 |
| IUPAC Name | (2S)-2-[[[2,6-di(propan-2-yl)phenoxy]-ethoxyphosphoryl]-pentan-3-ylamino]-3-phenylpropanoic acid |
| SMILES | CCOP(=O)(Oc1c(C(C)C)cccc1C(C)C)N(C(CC)CC)[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C28H42NO5P/c1-8-23(9-2)29(26(28(30)31)19-22-15-12-11-13-16-22)35(32,33-10-3)34-27-24(20(4)5)17-14-18-25(27)21(6)7/h11-18,20-21,23,26H,8-10,19H2,1-7H3,(H,30,31)/t26-,35?/m0/s1 |
| InChIKey | ILVRTBVXOQXMCD-HJYWNDIWSA-N |
| XLogP | 7.64 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.62 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|