C22H38NO5P — CID 130324165
[(2R)-butan-2-yl] (2S)-2-[[(2-butan-2-yl-6-propylphenoxy)-(methoxymethyl)phosphoryl]amino]propanoate (PubChem CID 130324165) has the molecular formula C22H38NO5P and a molecular weight of 427.52 g/mol. Its IUPAC name is [(2R)-butan-2-yl] (2S)-2-[[(2-butan-2-yl-6-propylphenoxy)-(methoxymethyl)phosphoryl]amino]propanoate.
| Compound Name | [(2R)-butan-2-yl] (2S)-2-[[(2-butan-2-yl-6-propylphenoxy)-(methoxymethyl)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 130324165 |
| Molecular Formula | C22H38NO5P |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | [(2R)-butan-2-yl] (2S)-2-[[(2-butan-2-yl-6-propylphenoxy)-(methoxymethyl)phosphoryl]amino]propanoate |
| SMILES | CCCc1cccc(C(C)CC)c1OP(=O)(COC)N[C@@H](C)C(=O)O[C@H](C)CC |
| InChI | InChI=1S/C22H38NO5P/c1-8-12-19-13-11-14-20(16(4)9-2)21(19)28-29(25,15-26-7)23-18(6)22(24)27-17(5)10-3/h11,13-14,16-18H,8-10,12,15H2,1-7H3,(H,23,25)/t16?,17-,18+,29?/m1/s1 |
| InChIKey | ZCYOVAANCWWDKY-COPPVITQSA-N |
| XLogP | 5.65 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|