C19H20F3N3O — CID 137474559
N-butyl-1-[[3-(trifluoromethoxy)phenyl]methyl]benzimidazol-2-amine (PubChem CID 137474559) has the molecular formula C19H20F3N3O and a molecular weight of 363.38 g/mol. Its IUPAC name is N-butyl-1-[[3-(trifluoromethoxy)phenyl]methyl]benzimidazol-2-amine.
| Compound Name | N-butyl-1-[[3-(trifluoromethoxy)phenyl]methyl]benzimidazol-2-amine |
|---|---|
| PubChem CID | 137474559 |
| Molecular Formula | C19H20F3N3O |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | N-butyl-1-[[3-(trifluoromethoxy)phenyl]methyl]benzimidazol-2-amine |
| SMILES | CCCCNc1nc2ccccc2n1Cc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C19H20F3N3O/c1-2-3-11-23-18-24-16-9-4-5-10-17(16)25(18)13-14-7-6-8-15(12-14)26-19(20,21)22/h4-10,12H,2-3,11,13H2,1H3,(H,23,24) |
| InChIKey | MFFPWTDFKXRXTA-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|