C15H22IN5O3 — CID 137476187
tert-butyl 3-(5-iodo-4-oxo-4a,5-dihydro-3H-imidazo[5,1-f][1,2,4]triazin-7-yl)piperidine-1-carboxylate (PubChem CID 137476187) has the molecular formula C15H22IN5O3 and a molecular weight of 447.28 g/mol. Its IUPAC name is tert-butyl 3-(5-iodo-4-oxo-4a,5-dihydro-3H-imidazo[5,1-f][1,2,4]triazin-7-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(5-iodo-4-oxo-4a,5-dihydro-3H-imidazo[5,1-f][1,2,4]triazin-7-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 137476187 |
| Molecular Formula | C15H22IN5O3 |
| Molecular Weight | 447.28 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | tert-butyl 3-(5-iodo-4-oxo-4a,5-dihydro-3H-imidazo[5,1-f][1,2,4]triazin-7-yl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C2=NC(I)C3C(=O)NC=NN23)C1 |
| InChI | InChI=1S/C15H22IN5O3/c1-15(2,3)24-14(23)20-6-4-5-9(7-20)12-19-11(16)10-13(22)17-8-18-21(10)12/h8-11H,4-7H2,1-3H3,(H,17,18,22) |
| InChIKey | BSCGUBQNFQHPQP-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 86.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.28 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|