C22H18NO2S2+ — CID 137477217
2-[(E)-2-[5-(1,3-benzodioxol-5-yl)thiophen-2-yl]ethenyl]-3-ethyl-1,3-benzothiazol-3-ium (PubChem CID 137477217) has the molecular formula C22H18NO2S2+ and a molecular weight of 392.53 g/mol. Its IUPAC name is 2-[(E)-2-[5-(1,3-benzodioxol-5-yl)thiophen-2-yl]ethenyl]-3-ethyl-1,3-benzothiazol-3-ium.
| Compound Name | 2-[(E)-2-[5-(1,3-benzodioxol-5-yl)thiophen-2-yl]ethenyl]-3-ethyl-1,3-benzothiazol-3-ium |
|---|---|
| PubChem CID | 137477217 |
| Molecular Formula | C22H18NO2S2+ |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 2-[(E)-2-[5-(1,3-benzodioxol-5-yl)thiophen-2-yl]ethenyl]-3-ethyl-1,3-benzothiazol-3-ium |
| SMILES | CC[n+]1c(/C=C/c2ccc(-c3ccc4c(c3)OCO4)s2)sc2ccccc21 |
| InChI | InChI=1S/C22H18NO2S2/c1-2-23-17-5-3-4-6-21(17)27-22(23)12-9-16-8-11-20(26-16)15-7-10-18-19(13-15)25-14-24-18/h3-13H,2,14H2,1H3/q+1/b12-9+ |
| InChIKey | QOWLKVJHJFSILO-FMIVXFBMSA-N |
| XLogP | 5.84 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|