C30H29FN3O8P — CID 137479802
[3-acetyl-1-[2-[(2S,4R)-4-fluoro-2-[(3-phenoxyphenyl)carbamoyl]pyrrolidin-1-yl]-2-oxoethyl]indol-6-yl]peroxy-methylphosphinic acid (PubChem CID 137479802) has the molecular formula C30H29FN3O8P and a molecular weight of 609.55 g/mol. Its IUPAC name is [3-acetyl-1-[2-[(2S,4R)-4-fluoro-2-[(3-phenoxyphenyl)carbamoyl]pyrrolidin-1-yl]-2-oxoethyl]indol-6-yl]peroxy-methylphosphinic acid.
| Compound Name | [3-acetyl-1-[2-[(2S,4R)-4-fluoro-2-[(3-phenoxyphenyl)carbamoyl]pyrrolidin-1-yl]-2-oxoethyl]indol-6-yl]peroxy-methylphosphinic acid |
|---|---|
| PubChem CID | 137479802 |
| Molecular Formula | C30H29FN3O8P |
| Molecular Weight | 609.55 g/mol |
| Exact Mass | 609.17 |
| IUPAC Name | [3-acetyl-1-[2-[(2S,4R)-4-fluoro-2-[(3-phenoxyphenyl)carbamoyl]pyrrolidin-1-yl]-2-oxoethyl]indol-6-yl]peroxy-methylphosphinic acid |
| SMILES | CC(=O)c1cn(CC(=O)N2C[C@H](F)C[C@H]2C(=O)Nc2cccc(Oc3ccccc3)c2)c2cc(OOP(C)(=O)O)ccc12 |
| InChI | InChI=1S/C30H29FN3O8P/c1-19(35)26-17-33(27-15-24(11-12-25(26)27)41-42-43(2,38)39)18-29(36)34-16-20(31)13-28(34)30(37)32-21-7-6-10-23(14-21)40-22-8-4-3-5-9-22/h3-12,14-15,17,20,28H,13,16,18H2,1-2H3,(H,32,37)(H,38,39)/t20-,28+/m1/s1 |
| InChIKey | JAZXRXACXLGYTJ-NGOKVRLYSA-N |
| XLogP | 5.34 |
| TPSA | 136.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.55 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|