About 2-chloro-N,7-diethylpyrrolo[2,3-d]pyrimidine-6-carboxamide
2-chloro-N,7-diethylpyrrolo[2,3-d]pyrimidine-6-carboxamide (PubChem CID 137482872) has the molecular formula C11H13ClN4O
and a molecular weight of 252.70 g/mol. Its IUPAC name is 2-chloro-N,7-diethylpyrrolo[2,3-d]pyrimidine-6-carboxamide.
Molecular Properties
| Compound Name | 2-chloro-N,7-diethylpyrrolo[2,3-d]pyrimidine-6-carboxamide |
| PubChem CID | 137482872 |
| Molecular Formula | C11H13ClN4O |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 2-chloro-N,7-diethylpyrrolo[2,3-d]pyrimidine-6-carboxamide |
| SMILES | CCNC(=O)c1cc2cnc(Cl)nc2n1CC |
| InChI | InChI=1S/C11H13ClN4O/c1-3-13-10(17)8-5-7-6-14-11(12)15-9(7)16(8)4-2/h5-6H,3-4H2,1-2H3,(H,13,17) |
| InChIKey | GCHYKSLLDRFKFX-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-N,7-diethylpyrrolo[2,3-d]pyrimidine-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N,7-diethylpyrrolo[2,3-d]pyrimidine-6-carboxamide?
The IUPAC name of 2-chloro-N,7-diethylpyrrolo[2,3-d]pyrimidine-6-carboxamide (CID 137482872) is 2-chloro-N,7-diethylpyrrolo[2,3-d]pyrimidine-6-carboxamide.
What is the SMILES notation for 2-chloro-N,7-diethylpyrrolo[2,3-d]pyrimidine-6-carboxamide?
The canonical SMILES for 2-chloro-N,7-diethylpyrrolo[2,3-d]pyrimidine-6-carboxamide is CCNC(=O)c1cc2cnc(Cl)nc2n1CC.
What is the InChIKey of 2-chloro-N,7-diethylpyrrolo[2,3-d]pyrimidine-6-carboxamide?
The InChIKey is GCHYKSLLDRFKFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClN4O/c1-3-13-10(17)8-5-7-6-14-11(12)15-9(7)16(8)4-2/h5-6H,3-4H2,1-2H3,(H,13,17).
What are the key properties of 2-chloro-N,7-diethylpyrrolo[2,3-d]pyrimidine-6-carboxamide?
2-chloro-N,7-diethylpyrrolo[2,3-d]pyrimidine-6-carboxamide has a molecular weight of 252.70 g/mol, XLogP of 1.85, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N,7-diethylpyrrolo[2,3-d]pyrimidine-6-carboxamide is sourced from PubChem (CID 137482872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).