C14H17ClN4O3 — CID 86695605
tert-butyl N-[2-(2-chloro-6-formylpyrrolo[2,3-d]pyrimidin-7-yl)ethyl]carbamate (PubChem CID 86695605) has the molecular formula C14H17ClN4O3 and a molecular weight of 324.77 g/mol. Its IUPAC name is tert-butyl N-[2-(2-chloro-6-formylpyrrolo[2,3-d]pyrimidin-7-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(2-chloro-6-formylpyrrolo[2,3-d]pyrimidin-7-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 86695605 |
| Molecular Formula | C14H17ClN4O3 |
| Molecular Weight | 324.77 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | tert-butyl N-[2-(2-chloro-6-formylpyrrolo[2,3-d]pyrimidin-7-yl)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCn1c(C=O)cc2cnc(Cl)nc21 |
| InChI | InChI=1S/C14H17ClN4O3/c1-14(2,3)22-13(21)16-4-5-19-10(8-20)6-9-7-17-12(15)18-11(9)19/h6-8H,4-5H2,1-3H3,(H,16,21) |
| InChIKey | OQDLNTMUQOBGON-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.77 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|