C18H27ClN4O4 — CID 87428127
tert-butyl N-[2-[2-chloro-6-(diethoxymethyl)pyrrolo[2,3-d]pyrimidin-7-yl]ethyl]carbamate (PubChem CID 87428127) has the molecular formula C18H27ClN4O4 and a molecular weight of 398.89 g/mol. Its IUPAC name is tert-butyl N-[2-[2-chloro-6-(diethoxymethyl)pyrrolo[2,3-d]pyrimidin-7-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-chloro-6-(diethoxymethyl)pyrrolo[2,3-d]pyrimidin-7-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 87428127 |
| Molecular Formula | C18H27ClN4O4 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | tert-butyl N-[2-[2-chloro-6-(diethoxymethyl)pyrrolo[2,3-d]pyrimidin-7-yl]ethyl]carbamate |
| SMILES | CCOC(OCC)c1cc2cnc(Cl)nc2n1CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H27ClN4O4/c1-6-25-15(26-7-2)13-10-12-11-21-16(19)22-14(12)23(13)9-8-20-17(24)27-18(3,4)5/h10-11,15H,6-9H2,1-5H3,(H,20,24) |
| InChIKey | WFZSPMOWKRQQKD-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|