C15H17N3O2 — CID 137484331
1-ethyl-N'-(4-methylphenyl)-6-oxopyridine-3-carbohydrazide (PubChem CID 137484331) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is 1-ethyl-N'-(4-methylphenyl)-6-oxopyridine-3-carbohydrazide.
| Compound Name | 1-ethyl-N'-(4-methylphenyl)-6-oxopyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 137484331 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 1-ethyl-N'-(4-methylphenyl)-6-oxopyridine-3-carbohydrazide |
| SMILES | CCn1cc(C(=O)NNc2ccc(C)cc2)ccc1=O |
| InChI | InChI=1S/C15H17N3O2/c1-3-18-10-12(6-9-14(18)19)15(20)17-16-13-7-4-11(2)5-8-13/h4-10,16H,3H2,1-2H3,(H,17,20) |
| InChIKey | XPMMYVLTMAHASZ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|