C21H17F2N3O3 — CID 122632925
1-[2-[4-(fluoromethyl)phenyl]-2-oxoethyl]-N'-(4-fluorophenyl)-6-oxopyridine-3-carbohydrazide (PubChem CID 122632925) has the molecular formula C21H17F2N3O3 and a molecular weight of 397.38 g/mol. Its IUPAC name is 1-[2-[4-(fluoromethyl)phenyl]-2-oxoethyl]-N'-(4-fluorophenyl)-6-oxopyridine-3-carbohydrazide.
| Compound Name | 1-[2-[4-(fluoromethyl)phenyl]-2-oxoethyl]-N'-(4-fluorophenyl)-6-oxopyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 122632925 |
| Molecular Formula | C21H17F2N3O3 |
| Molecular Weight | 397.38 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 1-[2-[4-(fluoromethyl)phenyl]-2-oxoethyl]-N'-(4-fluorophenyl)-6-oxopyridine-3-carbohydrazide |
| SMILES | O=C(Cn1cc(C(=O)NNc2ccc(F)cc2)ccc1=O)c1ccc(CF)cc1 |
| InChI | InChI=1S/C21H17F2N3O3/c22-11-14-1-3-15(4-2-14)19(27)13-26-12-16(5-10-20(26)28)21(29)25-24-18-8-6-17(23)7-9-18/h1-10,12,24H,11,13H2,(H,25,29) |
| InChIKey | APNDTRPGOHYRMP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|