C18H13ClFN3O2 — CID 118039631
1-(3-chlorophenyl)-N'-(4-fluorophenyl)-6-oxopyridine-3-carbohydrazide (PubChem CID 118039631) has the molecular formula C18H13ClFN3O2 and a molecular weight of 357.77 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N'-(4-fluorophenyl)-6-oxopyridine-3-carbohydrazide.
| Compound Name | 1-(3-chlorophenyl)-N'-(4-fluorophenyl)-6-oxopyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 118039631 |
| Molecular Formula | C18H13ClFN3O2 |
| Molecular Weight | 357.77 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 1-(3-chlorophenyl)-N'-(4-fluorophenyl)-6-oxopyridine-3-carbohydrazide |
| SMILES | O=C(NNc1ccc(F)cc1)c1ccc(=O)n(-c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C18H13ClFN3O2/c19-13-2-1-3-16(10-13)23-11-12(4-9-17(23)24)18(25)22-21-15-7-5-14(20)6-8-15/h1-11,21H,(H,22,25) |
| InChIKey | CQKZISPLUBPNFA-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.77 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|