C19H15FN2O3 — CID 172676933
N'-(4-fluorophenyl)-4-(4-hydroxyphenoxy)benzohydrazide (PubChem CID 172676933) has the molecular formula C19H15FN2O3 and a molecular weight of 338.34 g/mol. Its IUPAC name is N'-(4-fluorophenyl)-4-(4-hydroxyphenoxy)benzohydrazide.
| Compound Name | N'-(4-fluorophenyl)-4-(4-hydroxyphenoxy)benzohydrazide |
|---|---|
| PubChem CID | 172676933 |
| Molecular Formula | C19H15FN2O3 |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | N'-(4-fluorophenyl)-4-(4-hydroxyphenoxy)benzohydrazide |
| SMILES | O=C(NNc1ccc(F)cc1)c1ccc(Oc2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C19H15FN2O3/c20-14-3-5-15(6-4-14)21-22-19(24)13-1-9-17(10-2-13)25-18-11-7-16(23)8-12-18/h1-12,21,23H,(H,22,24) |
| InChIKey | LFNLFYJRJWLTQS-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|