About (5Z,6E)-6-ethylidene-5-prop-2-enylidene-1,3-oxazinane
(5Z,6E)-6-ethylidene-5-prop-2-enylidene-1,3-oxazinane (PubChem CID 137487544) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is (5Z,6E)-6-ethylidene-5-prop-2-enylidene-1,3-oxazinane.
Analyze (5Z,6E)-6-ethylidene-5-prop-2-enylidene-1,3-oxazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z,6E)-6-ethylidene-5-prop-2-enylidene-1,3-oxazinane?
The IUPAC name of (5Z,6E)-6-ethylidene-5-prop-2-enylidene-1,3-oxazinane (CID 137487544) is (5Z,6E)-6-ethylidene-5-prop-2-enylidene-1,3-oxazinane.
What is the SMILES notation for (5Z,6E)-6-ethylidene-5-prop-2-enylidene-1,3-oxazinane?
The canonical SMILES for (5Z,6E)-6-ethylidene-5-prop-2-enylidene-1,3-oxazinane is C=C/C=C1/CNCO/C1=C/C.
What is the InChIKey of (5Z,6E)-6-ethylidene-5-prop-2-enylidene-1,3-oxazinane?
The InChIKey is CKELKJOYNYKLCR-JDNPHIJCSA-N. The full InChI is InChI=1S/C9H13NO/c1-3-5-8-6-10-7-11-9(8)4-2/h3-5,10H,1,6-7H2,2H3/b8-5-,9-4+.
What are the key properties of (5Z,6E)-6-ethylidene-5-prop-2-enylidene-1,3-oxazinane?
(5Z,6E)-6-ethylidene-5-prop-2-enylidene-1,3-oxazinane has a molecular weight of 151.21 g/mol, XLogP of 1.58, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z,6E)-6-ethylidene-5-prop-2-enylidene-1,3-oxazinane is sourced from PubChem (CID 137487544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).