C17H24FNO — CID 137488217
5-[4-(4-fluorophenyl)butyl]azepane-2-carbaldehyde (PubChem CID 137488217) has the molecular formula C17H24FNO and a molecular weight of 277.38 g/mol. Its IUPAC name is 5-[4-(4-fluorophenyl)butyl]azepane-2-carbaldehyde.
| Compound Name | 5-[4-(4-fluorophenyl)butyl]azepane-2-carbaldehyde |
|---|---|
| PubChem CID | 137488217 |
| Molecular Formula | C17H24FNO |
| Molecular Weight | 277.38 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 5-[4-(4-fluorophenyl)butyl]azepane-2-carbaldehyde |
| SMILES | O=CC1CCC(CCCCc2ccc(F)cc2)CCN1 |
| InChI | InChI=1S/C17H24FNO/c18-16-8-5-14(6-9-16)3-1-2-4-15-7-10-17(13-20)19-12-11-15/h5-6,8-9,13,15,17,19H,1-4,7,10-12H2 |
| InChIKey | ZHHRNFSVFTXYSE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|