C9H11N3 — CID 137488696
7-ethylpyrazolo[1,5-a]pyridin-3-amine (PubChem CID 137488696) has the molecular formula C9H11N3 and a molecular weight of 161.21 g/mol. Its IUPAC name is 7-ethylpyrazolo[1,5-a]pyridin-3-amine.
| Compound Name | 7-ethylpyrazolo[1,5-a]pyridin-3-amine |
|---|---|
| PubChem CID | 137488696 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 7-ethylpyrazolo[1,5-a]pyridin-3-amine |
| SMILES | CCc1cccc2c(N)cnn12 |
| InChI | InChI=1S/C9H11N3/c1-2-7-4-3-5-9-8(10)6-11-12(7)9/h3-6H,2,10H2,1H3 |
| InChIKey | ZXKVSZCBTTUHIG-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |