C7H10N4O — CID 69255460
1-ethoxypyrazolo[1,5-b]pyrazol-4-amine (PubChem CID 69255460) has the molecular formula C7H10N4O and a molecular weight of 166.18 g/mol. Its IUPAC name is 1-ethoxypyrazolo[1,5-b]pyrazol-4-amine.
| Compound Name | 1-ethoxypyrazolo[1,5-b]pyrazol-4-amine |
|---|---|
| PubChem CID | 69255460 |
| Molecular Formula | C7H10N4O |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | 1-ethoxypyrazolo[1,5-b]pyrazol-4-amine |
| SMILES | CCOn1ccc2c(N)cnn21 |
| InChI | InChI=1S/C7H10N4O/c1-2-12-10-4-3-7-6(8)5-9-11(7)10/h3-5H,2,8H2,1H3 |
| InChIKey | RYVCWGQMXANYSG-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |