C6H10N6O — CID 69255677
3-ethoxyimidazo[1,5-b][1,2,4]triazole-5,7-diamine (PubChem CID 69255677) has the molecular formula C6H10N6O and a molecular weight of 182.19 g/mol. Its IUPAC name is 3-ethoxyimidazo[1,5-b][1,2,4]triazole-5,7-diamine.
| Compound Name | 3-ethoxyimidazo[1,5-b][1,2,4]triazole-5,7-diamine |
|---|---|
| PubChem CID | 69255677 |
| Molecular Formula | C6H10N6O |
| Molecular Weight | 182.19 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 3-ethoxyimidazo[1,5-b][1,2,4]triazole-5,7-diamine |
| SMILES | CCOn1cnc2c(N)nc(N)n21 |
| InChI | InChI=1S/C6H10N6O/c1-2-13-11-3-9-5-4(7)10-6(8)12(5)11/h3H,2,7H2,1H3,(H2,8,10) |
| InChIKey | DQSOYDMQWOWKRN-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 96.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.19 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |