About 2-(7-aminoimidazo[1,5-b][1,2,4]triazol-3-yl)oxyethanol
2-(7-aminoimidazo[1,5-b][1,2,4]triazol-3-yl)oxyethanol (PubChem CID 69255488) has the molecular formula C6H9N5O2
and a molecular weight of 183.17 g/mol. Its IUPAC name is 2-(7-aminoimidazo[1,5-b][1,2,4]triazol-3-yl)oxyethanol.
Analyze 2-(7-aminoimidazo[1,5-b][1,2,4]triazol-3-yl)oxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7-aminoimidazo[1,5-b][1,2,4]triazol-3-yl)oxyethanol?
The IUPAC name of 2-(7-aminoimidazo[1,5-b][1,2,4]triazol-3-yl)oxyethanol (CID 69255488) is 2-(7-aminoimidazo[1,5-b][1,2,4]triazol-3-yl)oxyethanol.
What is the SMILES notation for 2-(7-aminoimidazo[1,5-b][1,2,4]triazol-3-yl)oxyethanol?
The canonical SMILES for 2-(7-aminoimidazo[1,5-b][1,2,4]triazol-3-yl)oxyethanol is Nc1ncn2c1ncn2OCCO.
What is the InChIKey of 2-(7-aminoimidazo[1,5-b][1,2,4]triazol-3-yl)oxyethanol?
The InChIKey is SEGSHKIZMDGKOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N5O2/c7-5-6-9-4-11(13-2-1-12)10(6)3-8-5/h3-4,12H,1-2,7H2.
What are the key properties of 2-(7-aminoimidazo[1,5-b][1,2,4]triazol-3-yl)oxyethanol?
2-(7-aminoimidazo[1,5-b][1,2,4]triazol-3-yl)oxyethanol has a molecular weight of 183.17 g/mol, XLogP of -1.47, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-aminoimidazo[1,5-b][1,2,4]triazol-3-yl)oxyethanol is sourced from PubChem (CID 69255488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).