C8H10N2O3S — CID 69340976
5-amino-4-(2-hydroxyethoxy)thieno[3,2-b]pyrrol-2-ol (PubChem CID 69340976) has the molecular formula C8H10N2O3S and a molecular weight of 214.25 g/mol. Its IUPAC name is 5-amino-4-(2-hydroxyethoxy)thieno[3,2-b]pyrrol-2-ol.
| Compound Name | 5-amino-4-(2-hydroxyethoxy)thieno[3,2-b]pyrrol-2-ol |
|---|---|
| PubChem CID | 69340976 |
| Molecular Formula | C8H10N2O3S |
| Molecular Weight | 214.25 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | 5-amino-4-(2-hydroxyethoxy)thieno[3,2-b]pyrrol-2-ol |
| SMILES | Nc1cc2sc(O)cc2n1OCCO |
| InChI | InChI=1S/C8H10N2O3S/c9-7-4-6-5(3-8(12)14-6)10(7)13-2-1-11/h3-4,11-12H,1-2,9H2 |
| InChIKey | NJKFODNAGJLBKT-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.25 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |