C10H12N2O2S — CID 45077316
2-[(5-amino-1,3-benzothiazol-2-yl)methoxy]ethanol (PubChem CID 45077316) has the molecular formula C10H12N2O2S and a molecular weight of 224.28 g/mol. Its IUPAC name is 2-[(5-amino-1,3-benzothiazol-2-yl)methoxy]ethanol.
| Compound Name | 2-[(5-amino-1,3-benzothiazol-2-yl)methoxy]ethanol |
|---|---|
| PubChem CID | 45077316 |
| Molecular Formula | C10H12N2O2S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 2-[(5-amino-1,3-benzothiazol-2-yl)methoxy]ethanol |
| SMILES | Nc1ccc2sc(COCCO)nc2c1 |
| InChI | InChI=1S/C10H12N2O2S/c11-7-1-2-9-8(5-7)12-10(15-9)6-14-4-3-13/h1-2,5,13H,3-4,6,11H2 |
| InChIKey | OXMRZKSGBCTHEL-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 68.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|