C24H26N6O2S — CID 137490081
[6-[(2R)-1-(dimethylamino)-3-phenylpropan-2-yl]oxy-3-pyridinyl]-[(5-pyridin-4-yl-1,3,4-thiadiazol-2-yl)amino]methanol (PubChem CID 137490081) has the molecular formula C24H26N6O2S and a molecular weight of 462.58 g/mol. Its IUPAC name is [6-[(2R)-1-(dimethylamino)-3-phenylpropan-2-yl]oxy-3-pyridinyl]-[(5-pyridin-4-yl-1,3,4-thiadiazol-2-yl)amino]methanol.
| Compound Name | [6-[(2R)-1-(dimethylamino)-3-phenylpropan-2-yl]oxy-3-pyridinyl]-[(5-pyridin-4-yl-1,3,4-thiadiazol-2-yl)amino]methanol |
|---|---|
| PubChem CID | 137490081 |
| Molecular Formula | C24H26N6O2S |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | [6-[(2R)-1-(dimethylamino)-3-phenylpropan-2-yl]oxy-3-pyridinyl]-[(5-pyridin-4-yl-1,3,4-thiadiazol-2-yl)amino]methanol |
| SMILES | CN(C)C[C@@H](Cc1ccccc1)Oc1ccc(C(O)Nc2nnc(-c3ccncc3)s2)cn1 |
| InChI | InChI=1S/C24H26N6O2S/c1-30(2)16-20(14-17-6-4-3-5-7-17)32-21-9-8-19(15-26-21)22(31)27-24-29-28-23(33-24)18-10-12-25-13-11-18/h3-13,15,20,22,31H,14,16H2,1-2H3,(H,27,29)/t20-,22?/m1/s1 |
| InChIKey | KCGVJIAFTVSJJV-PSDZMVHGSA-N |
| XLogP | 3.65 |
| TPSA | 96.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|