C23H23Cl2N5O3S — CID 137491335
1-[2-(4-aminophenyl)ethyl]-3-(2,6-dichloro-3,5-dimethoxyphenyl)-7-methylsulfanyl-4H-pyrimido[4,5-d]pyrimidin-2-one (PubChem CID 137491335) has the molecular formula C23H23Cl2N5O3S and a molecular weight of 520.44 g/mol. Its IUPAC name is 1-[2-(4-aminophenyl)ethyl]-3-(2,6-dichloro-3,5-dimethoxyphenyl)-7-methylsulfanyl-4H-pyrimido[4,5-d]pyrimidin-2-one.
| Compound Name | 1-[2-(4-aminophenyl)ethyl]-3-(2,6-dichloro-3,5-dimethoxyphenyl)-7-methylsulfanyl-4H-pyrimido[4,5-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 137491335 |
| Molecular Formula | C23H23Cl2N5O3S |
| Molecular Weight | 520.44 g/mol |
| Exact Mass | 519.09 |
| IUPAC Name | 1-[2-(4-aminophenyl)ethyl]-3-(2,6-dichloro-3,5-dimethoxyphenyl)-7-methylsulfanyl-4H-pyrimido[4,5-d]pyrimidin-2-one |
| SMILES | COc1cc(OC)c(Cl)c(N2Cc3cnc(SC)nc3N(CCc3ccc(N)cc3)C2=O)c1Cl |
| InChI | InChI=1S/C23H23Cl2N5O3S/c1-32-16-10-17(33-2)19(25)20(18(16)24)30-12-14-11-27-22(34-3)28-21(14)29(23(30)31)9-8-13-4-6-15(26)7-5-13/h4-7,10-11H,8-9,12,26H2,1-3H3 |
| InChIKey | BSAFZHISMZNDFK-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.44 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|