C11H13NO3 — CID 137491853
1-methoxy-3,4-bis[(Z)-prop-1-enyl]pyrrole-2,5-dione (PubChem CID 137491853) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is 1-methoxy-3,4-bis[(Z)-prop-1-enyl]pyrrole-2,5-dione.
| Compound Name | 1-methoxy-3,4-bis[(Z)-prop-1-enyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 137491853 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 1-methoxy-3,4-bis[(Z)-prop-1-enyl]pyrrole-2,5-dione |
| SMILES | C/C=C\C1=C(/C=C\C)C(=O)N(OC)C1=O |
| InChI | InChI=1S/C11H13NO3/c1-4-6-8-9(7-5-2)11(14)12(15-3)10(8)13/h4-7H,1-3H3/b6-4-,7-5- |
| InChIKey | YCIZAUWOLCSSLU-PEPZGXQESA-N |
| XLogP | 1.37 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|