C14H18N2O2 — CID 143039857
3,4-bis[(Z)-prop-1-enyl]-7,8,9,9a-tetrahydro-2H-pyrrolo[1,2-a][1,4]diazepine-1,5-dione (PubChem CID 143039857) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 3,4-bis[(Z)-prop-1-enyl]-7,8,9,9a-tetrahydro-2H-pyrrolo[1,2-a][1,4]diazepine-1,5-dione.
| Compound Name | 3,4-bis[(Z)-prop-1-enyl]-7,8,9,9a-tetrahydro-2H-pyrrolo[1,2-a][1,4]diazepine-1,5-dione |
|---|---|
| PubChem CID | 143039857 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 3,4-bis[(Z)-prop-1-enyl]-7,8,9,9a-tetrahydro-2H-pyrrolo[1,2-a][1,4]diazepine-1,5-dione |
| SMILES | C/C=C\C1=C(/C=C\C)C(=O)N2CCCC2C(=O)N1 |
| InChI | InChI=1S/C14H18N2O2/c1-3-6-10-11(7-4-2)15-13(17)12-8-5-9-16(12)14(10)18/h3-4,6-7,12H,5,8-9H2,1-2H3,(H,15,17)/b6-3-,7-4- |
| InChIKey | ILSVNMCRKHAFOZ-VKOMYYDGSA-N |
| XLogP | 1.51 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |