C27H49NO4 — CID 137496400
6-(5-cyano-3,3,6-trimethylheptan-2-yl)-2-(2,2-dimethylpropyl)-3,3,4,4-tetramethylheptanedioic acid (PubChem CID 137496400) has the molecular formula C27H49NO4 and a molecular weight of 451.69 g/mol. Its IUPAC name is 6-(5-cyano-3,3,6-trimethylheptan-2-yl)-2-(2,2-dimethylpropyl)-3,3,4,4-tetramethylheptanedioic acid.
| Compound Name | 6-(5-cyano-3,3,6-trimethylheptan-2-yl)-2-(2,2-dimethylpropyl)-3,3,4,4-tetramethylheptanedioic acid |
|---|---|
| PubChem CID | 137496400 |
| Molecular Formula | C27H49NO4 |
| Molecular Weight | 451.69 g/mol |
| Exact Mass | 451.37 |
| IUPAC Name | 6-(5-cyano-3,3,6-trimethylheptan-2-yl)-2-(2,2-dimethylpropyl)-3,3,4,4-tetramethylheptanedioic acid |
| SMILES | CC(C)C(C#N)CC(C)(C)C(C)C(CC(C)(C)C(C)(C)C(CC(C)(C)C)C(=O)O)C(=O)O |
| InChI | InChI=1S/C27H49NO4/c1-17(2)19(16-28)13-25(7,8)18(3)20(22(29)30)14-26(9,10)27(11,12)21(23(31)32)15-24(4,5)6/h17-21H,13-15H2,1-12H3,(H,29,30)(H,31,32) |
| InChIKey | LTWACFKREHVCJM-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 98.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.69 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |