C23H40N2O7S — CID 137497743
5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-2-[[(1R,4R)-2,3,4-trihydroxy-5-(hydroxymethyl)-1,2,3,4,5-pentamethylcyclohexyl]methyl]pentanoic acid (PubChem CID 137497743) has the molecular formula C23H40N2O7S and a molecular weight of 488.65 g/mol. Its IUPAC name is 5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-2-[[(1R,4R)-2,3,4-trihydroxy-5-(hydroxymethyl)-1,2,3,4,5-pentamethylcyclohexyl]methyl]pentanoic acid.
| Compound Name | 5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-2-[[(1R,4R)-2,3,4-trihydroxy-5-(hydroxymethyl)-1,2,3,4,5-pentamethylcyclohexyl]methyl]pentanoic acid |
|---|---|
| PubChem CID | 137497743 |
| Molecular Formula | C23H40N2O7S |
| Molecular Weight | 488.65 g/mol |
| Exact Mass | 488.26 |
| IUPAC Name | 5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-2-[[(1R,4R)-2,3,4-trihydroxy-5-(hydroxymethyl)-1,2,3,4,5-pentamethylcyclohexyl]methyl]pentanoic acid |
| SMILES | CC1(O)C(C)(O)[C@](C)(O)C(C)(CO)C[C@@]1(C)CC(CCCC1SC[C@@H]2NC(=O)N[C@H]12)C(=O)O |
| InChI | InChI=1S/C23H40N2O7S/c1-19(11-20(2,12-26)22(4,31)23(5,32)21(19,3)30)9-13(17(27)28)7-6-8-15-16-14(10-33-15)24-18(29)25-16/h13-16,26,30-32H,6-12H2,1-5H3,(H,27,28)(H2,24,25,29)/t13?,14-,15?,16-,19+,20?,21?,22+,23?/m0/s1 |
| InChIKey | VDVPXYOCBCIFMZ-XIENEEBQSA-N |
| XLogP | 1.07 |
| TPSA | 159.35 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.65 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|