C22H38N2O7S — CID 87674528
methyl 5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-2-[(2R,5S)-3,4,5-trihydroxy-2,3,4,5,6,6-hexamethyloxan-2-yl]pentanoate (PubChem CID 87674528) has the molecular formula C22H38N2O7S and a molecular weight of 474.62 g/mol. Its IUPAC name is methyl 5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-2-[(2R,5S)-3,4,5-trihydroxy-2,3,4,5,6,6-hexamethyloxan-2-yl]pentanoate.
| Compound Name | methyl 5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-2-[(2R,5S)-3,4,5-trihydroxy-2,3,4,5,6,6-hexamethyloxan-2-yl]pentanoate |
|---|---|
| PubChem CID | 87674528 |
| Molecular Formula | C22H38N2O7S |
| Molecular Weight | 474.62 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | methyl 5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-2-[(2R,5S)-3,4,5-trihydroxy-2,3,4,5,6,6-hexamethyloxan-2-yl]pentanoate |
| SMILES | COC(=O)C(CCCC1SC[C@@H]2NC(=O)N[C@H]12)[C@@]1(C)OC(C)(C)[C@@](C)(O)C(C)(O)C1(C)O |
| InChI | InChI=1S/C22H38N2O7S/c1-18(2)20(4,27)22(6,29)21(5,28)19(3,31-18)12(16(25)30-7)9-8-10-14-15-13(11-32-14)23-17(26)24-15/h12-15,27-29H,8-11H2,1-7H3,(H2,23,24,26)/t12?,13-,14?,15-,19+,20+,21?,22?/m0/s1 |
| InChIKey | LZBFTESSGLURAE-AAXBZEKWSA-N |
| XLogP | 0.93 |
| TPSA | 137.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.62 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|