C17H28N2O5S — CID 22847625
methyl 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-2-(6-methoxyoxan-2-yl)pentanoate (PubChem CID 22847625) has the molecular formula C17H28N2O5S and a molecular weight of 372.49 g/mol. Its IUPAC name is methyl 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-2-(6-methoxyoxan-2-yl)pentanoate.
| Compound Name | methyl 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-2-(6-methoxyoxan-2-yl)pentanoate |
|---|---|
| PubChem CID | 22847625 |
| Molecular Formula | C17H28N2O5S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | methyl 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-2-(6-methoxyoxan-2-yl)pentanoate |
| SMILES | COC(=O)C(CCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21)C1CCCC(OC)O1 |
| InChI | InChI=1S/C17H28N2O5S/c1-22-14-8-4-6-12(24-14)10(16(20)23-2)5-3-7-13-15-11(9-25-13)18-17(21)19-15/h10-15H,3-9H2,1-2H3,(H2,18,19,21)/t10?,11-,12?,13-,14?,15-/m0/s1 |
| InChIKey | UBJOFQQUKHAJOH-PBQSGJBNSA-N |
| XLogP | 1.65 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|