C20H32N2O7S — CID 134377932
[(3R,6S)-4,5,6-trihydroxy-1,3,4,6-tetramethyl-2-oxabicyclo[3.1.0]hexan-3-yl]methyl 5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate (PubChem CID 134377932) has the molecular formula C20H32N2O7S and a molecular weight of 444.55 g/mol. Its IUPAC name is [(3R,6S)-4,5,6-trihydroxy-1,3,4,6-tetramethyl-2-oxabicyclo[3.1.0]hexan-3-yl]methyl 5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate.
| Compound Name | [(3R,6S)-4,5,6-trihydroxy-1,3,4,6-tetramethyl-2-oxabicyclo[3.1.0]hexan-3-yl]methyl 5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate |
|---|---|
| PubChem CID | 134377932 |
| Molecular Formula | C20H32N2O7S |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | [(3R,6S)-4,5,6-trihydroxy-1,3,4,6-tetramethyl-2-oxabicyclo[3.1.0]hexan-3-yl]methyl 5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate |
| SMILES | CC12O[C@](C)(COC(=O)CCCCC3SC[C@@H]4NC(=O)N[C@H]34)C(C)(O)C1(O)[C@]2(C)O |
| InChI | InChI=1S/C20H32N2O7S/c1-16(17(2,25)20(27)18(3,26)19(20,4)29-16)10-28-13(23)8-6-5-7-12-14-11(9-30-12)21-15(24)22-14/h11-12,14,25-27H,5-10H2,1-4H3,(H2,21,22,24)/t11-,12?,14-,16+,17?,18+,19?,20?/m0/s1 |
| InChIKey | QRXCKFXQCGBAIM-ARARRJQHSA-N |
| XLogP | 0.05 |
| TPSA | 137.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|