C22H39N2O11PS — CID 87546869
[(2R,5S)-3,4,5-trihydroxy-2,3,4,5,6-pentamethyl-6-(phosphonooxymethyl)oxan-2-yl]methyl 5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate (PubChem CID 87546869) has the molecular formula C22H39N2O11PS and a molecular weight of 570.60 g/mol. Its IUPAC name is [(2R,5S)-3,4,5-trihydroxy-2,3,4,5,6-pentamethyl-6-(phosphonooxymethyl)oxan-2-yl]methyl 5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate.
| Compound Name | [(2R,5S)-3,4,5-trihydroxy-2,3,4,5,6-pentamethyl-6-(phosphonooxymethyl)oxan-2-yl]methyl 5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate |
|---|---|
| PubChem CID | 87546869 |
| Molecular Formula | C22H39N2O11PS |
| Molecular Weight | 570.60 g/mol |
| Exact Mass | 570.20 |
| IUPAC Name | [(2R,5S)-3,4,5-trihydroxy-2,3,4,5,6-pentamethyl-6-(phosphonooxymethyl)oxan-2-yl]methyl 5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate |
| SMILES | CC1(COP(=O)(O)O)O[C@](C)(COC(=O)CCCCC2SC[C@@H]3NC(=O)N[C@H]23)C(C)(O)C(C)(O)[C@]1(C)O |
| InChI | InChI=1S/C22H39N2O11PS/c1-18(11-33-15(25)9-7-6-8-14-16-13(10-37-14)23-17(26)24-16)20(3,27)22(5,29)21(4,28)19(2,35-18)12-34-36(30,31)32/h13-14,16,27-29H,6-12H2,1-5H3,(H2,23,24,26)(H2,30,31,32)/t13-,14?,16-,18+,19?,20?,21+,22?/m0/s1 |
| InChIKey | IWVBCPXEEFWFQL-BQPLQYRQSA-N |
| XLogP | 0.17 |
| TPSA | 204.11 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.60 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|