C12H22N3O6PS — CID 20740942
[2-aminoethoxy(hydroxy)phosphoryl] 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate (PubChem CID 20740942) has the molecular formula C12H22N3O6PS and a molecular weight of 367.36 g/mol. Its IUPAC name is [2-aminoethoxy(hydroxy)phosphoryl] 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate.
| Compound Name | [2-aminoethoxy(hydroxy)phosphoryl] 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate |
|---|---|
| PubChem CID | 20740942 |
| Molecular Formula | C12H22N3O6PS |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | [2-aminoethoxy(hydroxy)phosphoryl] 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate |
| SMILES | NCCOP(=O)(O)OC(=O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21 |
| InChI | InChI=1S/C12H22N3O6PS/c13-5-6-20-22(18,19)21-10(16)4-2-1-3-9-11-8(7-23-9)14-12(17)15-11/h8-9,11H,1-7,13H2,(H,18,19)(H2,14,15,17)/t8-,9-,11-/m0/s1 |
| InChIKey | OWCIUVKEKFNHOH-QXEWZRGKSA-N |
| XLogP | 0.33 |
| TPSA | 139.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|