(2,4-dibromo-6-methylphenyl) N-(3-methylphenyl)carbamate

C15H13Br2NO2 — CID 1376695

IUPAC(2,4-dibromo-6-methylphenyl) N-(3-methylphenyl)carbamate
SMILESCc1cccc(NC(=O)Oc2c(C)cc(Br)cc2Br)c1
InChIInChI=1S/C15H13Br2NO2/c1-9-4-3-5-12(6-9)18-15(19)20-14-10(2)7-11(16)8-13(14)17/h3-8H,1-2H3,(H,18,19)
InChIKeyKBIOJKDJTLXPSV-UHFFFAOYSA-N
MW399.08 g/mol
LogP5.44
Rot. Bonds2

About (2,4-dibromo-6-methylphenyl) N-(3-methylphenyl)carbamate

(2,4-dibromo-6-methylphenyl) N-(3-methylphenyl)carbamate (PubChem CID 1376695) has the molecular formula C15H13Br2NO2 and a molecular weight of 399.08 g/mol. Its IUPAC name is (2,4-dibromo-6-methylphenyl) N-(3-methylphenyl)carbamate.

Molecular Properties

Compound Name(2,4-dibromo-6-methylphenyl) N-(3-methylphenyl)carbamate
PubChem CID1376695
Molecular FormulaC15H13Br2NO2
Molecular Weight399.08 g/mol
Exact Mass396.93
IUPAC Name(2,4-dibromo-6-methylphenyl) N-(3-methylphenyl)carbamate
SMILESCc1cccc(NC(=O)Oc2c(C)cc(Br)cc2Br)c1
InChIInChI=1S/C15H13Br2NO2/c1-9-4-3-5-12(6-9)18-15(19)20-14-10(2)7-11(16)8-13(14)17/h3-8H,1-2H3,(H,18,19)
InChIKeyKBIOJKDJTLXPSV-UHFFFAOYSA-N
XLogP5.44
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms20
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500399.08
LogP ≤ 55.44
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze (2,4-dibromo-6-methylphenyl) N-(3-methylphenyl)carbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,4-dibromo-6-methylphenyl) N-(3-methylphenyl)carbamate?
The IUPAC name of (2,4-dibromo-6-methylphenyl) N-(3-methylphenyl)carbamate (CID 1376695) is (2,4-dibromo-6-methylphenyl) N-(3-methylphenyl)carbamate.
What is the SMILES notation for (2,4-dibromo-6-methylphenyl) N-(3-methylphenyl)carbamate?
The canonical SMILES for (2,4-dibromo-6-methylphenyl) N-(3-methylphenyl)carbamate is Cc1cccc(NC(=O)Oc2c(C)cc(Br)cc2Br)c1.
What is the InChIKey of (2,4-dibromo-6-methylphenyl) N-(3-methylphenyl)carbamate?
The InChIKey is KBIOJKDJTLXPSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13Br2NO2/c1-9-4-3-5-12(6-9)18-15(19)20-14-10(2)7-11(16)8-13(14)17/h3-8H,1-2H3,(H,18,19).
What are the key properties of (2,4-dibromo-6-methylphenyl) N-(3-methylphenyl)carbamate?
(2,4-dibromo-6-methylphenyl) N-(3-methylphenyl)carbamate has a molecular weight of 399.08 g/mol, XLogP of 5.44, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dibromo-6-methylphenyl) N-(3-methylphenyl)carbamate is sourced from PubChem (CID 1376695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).