C15H13Br2NO2 — CID 1376695
(2,4-dibromo-6-methylphenyl) N-(3-methylphenyl)carbamate (PubChem CID 1376695) has the molecular formula C15H13Br2NO2 and a molecular weight of 399.08 g/mol. Its IUPAC name is (2,4-dibromo-6-methylphenyl) N-(3-methylphenyl)carbamate.
| Compound Name | (2,4-dibromo-6-methylphenyl) N-(3-methylphenyl)carbamate |
|---|---|
| PubChem CID | 1376695 |
| Molecular Formula | C15H13Br2NO2 |
| Molecular Weight | 399.08 g/mol |
| Exact Mass | 396.93 |
| IUPAC Name | (2,4-dibromo-6-methylphenyl) N-(3-methylphenyl)carbamate |
| SMILES | Cc1cccc(NC(=O)Oc2c(C)cc(Br)cc2Br)c1 |
| InChI | InChI=1S/C15H13Br2NO2/c1-9-4-3-5-12(6-9)18-15(19)20-14-10(2)7-11(16)8-13(14)17/h3-8H,1-2H3,(H,18,19) |
| InChIKey | KBIOJKDJTLXPSV-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.08 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |