C18H11Cl2N3O — CID 1377130
N-[2-(2,4-dichlorophenyl)-3H-benzimidazol-5-yl]-1-(furan-2-yl)methanimine (PubChem CID 1377130) has the molecular formula C18H11Cl2N3O and a molecular weight of 356.21 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)-3H-benzimidazol-5-yl]-1-(furan-2-yl)methanimine.
| Compound Name | N-[2-(2,4-dichlorophenyl)-3H-benzimidazol-5-yl]-1-(furan-2-yl)methanimine |
|---|---|
| PubChem CID | 1377130 |
| Molecular Formula | C18H11Cl2N3O |
| Molecular Weight | 356.21 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)-3H-benzimidazol-5-yl]-1-(furan-2-yl)methanimine |
| SMILES | Clc1ccc(-c2nc3ccc(/N=C/c4ccco4)cc3[nH]2)c(Cl)c1 |
| InChI | InChI=1S/C18H11Cl2N3O/c19-11-3-5-14(15(20)8-11)18-22-16-6-4-12(9-17(16)23-18)21-10-13-2-1-7-24-13/h1-10H,(H,22,23)/b21-10+ |
| InChIKey | BHDOAHQEZRUMCQ-UFFVCSGVSA-N |
| XLogP | 5.88 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.21 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|