C21H13Cl3N4O — CID 110527081
2-(2-chlorophenyl)-N-[(E)-(2,4-dichlorophenyl)methylideneamino]-3H-benzimidazole-5-carboxamide (PubChem CID 110527081) has the molecular formula C21H13Cl3N4O and a molecular weight of 443.72 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-[(E)-(2,4-dichlorophenyl)methylideneamino]-3H-benzimidazole-5-carboxamide.
| Compound Name | 2-(2-chlorophenyl)-N-[(E)-(2,4-dichlorophenyl)methylideneamino]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 110527081 |
| Molecular Formula | C21H13Cl3N4O |
| Molecular Weight | 443.72 g/mol |
| Exact Mass | 442.02 |
| IUPAC Name | 2-(2-chlorophenyl)-N-[(E)-(2,4-dichlorophenyl)methylideneamino]-3H-benzimidazole-5-carboxamide |
| SMILES | O=C(N/N=C/c1ccc(Cl)cc1Cl)c1ccc2nc(-c3ccccc3Cl)[nH]c2c1 |
| InChI | InChI=1S/C21H13Cl3N4O/c22-14-7-5-13(17(24)10-14)11-25-28-21(29)12-6-8-18-19(9-12)27-20(26-18)15-3-1-2-4-16(15)23/h1-11H,(H,26,27)(H,28,29)/b25-11+ |
| InChIKey | OUGZCENHTLXYEJ-OPEKNORGSA-N |
| XLogP | 5.95 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.72 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|