C24H26O2 — CID 1377168
(6R)-3-[(E)-2-(4-ethoxyphenyl)ethenyl]-6-(2-phenylethyl)cyclohex-2-en-1-one (PubChem CID 1377168) has the molecular formula C24H26O2 and a molecular weight of 346.47 g/mol. Its IUPAC name is (6R)-3-[(E)-2-(4-ethoxyphenyl)ethenyl]-6-(2-phenylethyl)cyclohex-2-en-1-one.
| Compound Name | (6R)-3-[(E)-2-(4-ethoxyphenyl)ethenyl]-6-(2-phenylethyl)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 1377168 |
| Molecular Formula | C24H26O2 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | (6R)-3-[(E)-2-(4-ethoxyphenyl)ethenyl]-6-(2-phenylethyl)cyclohex-2-en-1-one |
| SMILES | CCOc1ccc(/C=C/C2=CC(=O)[C@H](CCc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C24H26O2/c1-2-26-23-16-12-20(13-17-23)8-9-21-11-15-22(24(25)18-21)14-10-19-6-4-3-5-7-19/h3-9,12-13,16-18,22H,2,10-11,14-15H2,1H3/b9-8+/t22-/m1/s1 |
| InChIKey | CZHBNSWWWKDMAY-HYGBKTPJSA-N |
| XLogP | 5.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |