C20H27N — CID 1377992
2,2-dimethyl-3-[(5S)-2-methyl-5-prop-1-en-2-ylcyclopenten-1-yl]-N-phenylpropan-1-imine (PubChem CID 1377992) has the molecular formula C20H27N and a molecular weight of 281.44 g/mol. Its IUPAC name is 2,2-dimethyl-3-[(5S)-2-methyl-5-prop-1-en-2-ylcyclopenten-1-yl]-N-phenylpropan-1-imine.
| Compound Name | 2,2-dimethyl-3-[(5S)-2-methyl-5-prop-1-en-2-ylcyclopenten-1-yl]-N-phenylpropan-1-imine |
|---|---|
| PubChem CID | 1377992 |
| Molecular Formula | C20H27N |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | 2,2-dimethyl-3-[(5S)-2-methyl-5-prop-1-en-2-ylcyclopenten-1-yl]-N-phenylpropan-1-imine |
| SMILES | C=C(C)[C@@H]1CCC(C)=C1CC(C)(C)/C=N/c1ccccc1 |
| InChI | InChI=1S/C20H27N/c1-15(2)18-12-11-16(3)19(18)13-20(4,5)14-21-17-9-7-6-8-10-17/h6-10,14,18H,1,11-13H2,2-5H3/b21-14+/t18-/m0/s1 |
| InChIKey | JAMWFWATPGELGK-SXZORUHJSA-N |
| XLogP | 6.11 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|