C14H21N5O2 — CID 138001192
N-[2-(cyclopropylamino)-2-oxoethyl]-1-piperidin-3-ylpyrazole-4-carboxamide (PubChem CID 138001192) has the molecular formula C14H21N5O2 and a molecular weight of 291.35 g/mol. Its IUPAC name is N-[2-(cyclopropylamino)-2-oxoethyl]-1-piperidin-3-ylpyrazole-4-carboxamide.
| Compound Name | N-[2-(cyclopropylamino)-2-oxoethyl]-1-piperidin-3-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 138001192 |
| Molecular Formula | C14H21N5O2 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | N-[2-(cyclopropylamino)-2-oxoethyl]-1-piperidin-3-ylpyrazole-4-carboxamide |
| SMILES | O=C(CNC(=O)c1cnn(C2CCCNC2)c1)NC1CC1 |
| InChI | InChI=1S/C14H21N5O2/c20-13(18-11-3-4-11)8-16-14(21)10-6-17-19(9-10)12-2-1-5-15-7-12/h6,9,11-12,15H,1-5,7-8H2,(H,16,21)(H,18,20) |
| InChIKey | YQKINKDRPSPDMF-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |