About (6-fluoro-6-methyl-1,4-diazepan-1-yl)-(6-imidazol-1-ylpyridazin-3-yl)methanone
(6-fluoro-6-methyl-1,4-diazepan-1-yl)-(6-imidazol-1-ylpyridazin-3-yl)methanone (PubChem CID 138001605) has the molecular formula C14H17FN6O
and a molecular weight of 304.33 g/mol. Its IUPAC name is (6-fluoro-6-methyl-1,4-diazepan-1-yl)-(6-imidazol-1-ylpyridazin-3-yl)methanone.
Molecular Properties
| Compound Name | (6-fluoro-6-methyl-1,4-diazepan-1-yl)-(6-imidazol-1-ylpyridazin-3-yl)methanone |
| PubChem CID | 138001605 |
| Molecular Formula | C14H17FN6O |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | (6-fluoro-6-methyl-1,4-diazepan-1-yl)-(6-imidazol-1-ylpyridazin-3-yl)methanone |
| SMILES | CC1(F)CNCCN(C(=O)c2ccc(-n3ccnc3)nn2)C1 |
| InChI | InChI=1S/C14H17FN6O/c1-14(15)8-16-4-6-20(9-14)13(22)11-2-3-12(19-18-11)21-7-5-17-10-21/h2-3,5,7,10,16H,4,6,8-9H2,1H3 |
| InChIKey | ACOUUSNVXSIBFD-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (6-fluoro-6-methyl-1,4-diazepan-1-yl)-(6-imidazol-1-ylpyridazin-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-fluoro-6-methyl-1,4-diazepan-1-yl)-(6-imidazol-1-ylpyridazin-3-yl)methanone?
The IUPAC name of (6-fluoro-6-methyl-1,4-diazepan-1-yl)-(6-imidazol-1-ylpyridazin-3-yl)methanone (CID 138001605) is (6-fluoro-6-methyl-1,4-diazepan-1-yl)-(6-imidazol-1-ylpyridazin-3-yl)methanone.
What is the SMILES notation for (6-fluoro-6-methyl-1,4-diazepan-1-yl)-(6-imidazol-1-ylpyridazin-3-yl)methanone?
The canonical SMILES for (6-fluoro-6-methyl-1,4-diazepan-1-yl)-(6-imidazol-1-ylpyridazin-3-yl)methanone is CC1(F)CNCCN(C(=O)c2ccc(-n3ccnc3)nn2)C1.
What is the InChIKey of (6-fluoro-6-methyl-1,4-diazepan-1-yl)-(6-imidazol-1-ylpyridazin-3-yl)methanone?
The InChIKey is ACOUUSNVXSIBFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17FN6O/c1-14(15)8-16-4-6-20(9-14)13(22)11-2-3-12(19-18-11)21-7-5-17-10-21/h2-3,5,7,10,16H,4,6,8-9H2,1H3.
What are the key properties of (6-fluoro-6-methyl-1,4-diazepan-1-yl)-(6-imidazol-1-ylpyridazin-3-yl)methanone?
(6-fluoro-6-methyl-1,4-diazepan-1-yl)-(6-imidazol-1-ylpyridazin-3-yl)methanone has a molecular weight of 304.33 g/mol, XLogP of 0.44, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (6-fluoro-6-methyl-1,4-diazepan-1-yl)-(6-imidazol-1-ylpyridazin-3-yl)methanone is sourced from PubChem (CID 138001605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).