C18H23N5O — CID 95140466
[(4R,4aR,8aS)-4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(6-imidazol-1-ylpyridazin-3-yl)methanone (PubChem CID 95140466) has the molecular formula C18H23N5O and a molecular weight of 325.42 g/mol. Its IUPAC name is [(4R,4aR,8aS)-4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(6-imidazol-1-ylpyridazin-3-yl)methanone.
| Compound Name | [(4R,4aR,8aS)-4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(6-imidazol-1-ylpyridazin-3-yl)methanone |
|---|---|
| PubChem CID | 95140466 |
| Molecular Formula | C18H23N5O |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | [(4R,4aR,8aS)-4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(6-imidazol-1-ylpyridazin-3-yl)methanone |
| SMILES | C[C@@H]1CCN(C(=O)c2ccc(-n3ccnc3)nn2)[C@H]2CCCC[C@H]12 |
| InChI | InChI=1S/C18H23N5O/c1-13-8-10-23(16-5-3-2-4-14(13)16)18(24)15-6-7-17(21-20-15)22-11-9-19-12-22/h6-7,9,11-14,16H,2-5,8,10H2,1H3/t13-,14-,16+/m1/s1 |
| InChIKey | WBEQYGUDLWDFTQ-FMKPAKJESA-N |
| XLogP | 2.70 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |