C12H10F3N5O — CID 138035562
(6-imidazol-1-ylpyridazin-3-yl)-[2-(trifluoromethyl)azetidin-1-yl]methanone (PubChem CID 138035562) has the molecular formula C12H10F3N5O and a molecular weight of 297.24 g/mol. Its IUPAC name is (6-imidazol-1-ylpyridazin-3-yl)-[2-(trifluoromethyl)azetidin-1-yl]methanone.
| Compound Name | (6-imidazol-1-ylpyridazin-3-yl)-[2-(trifluoromethyl)azetidin-1-yl]methanone |
|---|---|
| PubChem CID | 138035562 |
| Molecular Formula | C12H10F3N5O |
| Molecular Weight | 297.24 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | (6-imidazol-1-ylpyridazin-3-yl)-[2-(trifluoromethyl)azetidin-1-yl]methanone |
| SMILES | O=C(c1ccc(-n2ccnc2)nn1)N1CCC1C(F)(F)F |
| InChI | InChI=1S/C12H10F3N5O/c13-12(14,15)9-3-5-20(9)11(21)8-1-2-10(18-17-8)19-6-4-16-7-19/h1-2,4,6-7,9H,3,5H2 |
| InChIKey | HUEXEQBDHBUWBU-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.24 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |