C17H18N4O4 — CID 138001754
3-[[(2R,3R)-2-(2-methylpyrazol-3-yl)-6-oxopiperidin-3-yl]carbamoyl]benzoic acid (PubChem CID 138001754) has the molecular formula C17H18N4O4 and a molecular weight of 342.36 g/mol. Its IUPAC name is 3-[[(2R,3R)-2-(2-methylpyrazol-3-yl)-6-oxopiperidin-3-yl]carbamoyl]benzoic acid.
| Compound Name | 3-[[(2R,3R)-2-(2-methylpyrazol-3-yl)-6-oxopiperidin-3-yl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 138001754 |
| Molecular Formula | C17H18N4O4 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 3-[[(2R,3R)-2-(2-methylpyrazol-3-yl)-6-oxopiperidin-3-yl]carbamoyl]benzoic acid |
| SMILES | Cn1nccc1[C@@H]1NC(=O)CC[C@H]1NC(=O)c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C17H18N4O4/c1-21-13(7-8-18-21)15-12(5-6-14(22)20-15)19-16(23)10-3-2-4-11(9-10)17(24)25/h2-4,7-9,12,15H,5-6H2,1H3,(H,19,23)(H,20,22)(H,24,25)/t12-,15-/m1/s1 |
| InChIKey | WMAMXLSVAQNXFE-IUODEOHRSA-N |
| XLogP | 0.87 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |